About barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride
barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride (PubChem CID 175782399) has the molecular formula C4H3BaFN2O2
and a molecular weight of 267.41 g/mol. Its IUPAC name is barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride.
Molecular Properties
| Compound Name | barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride |
| PubChem CID | 175782399 |
| Molecular Formula | C4H3BaFN2O2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.92 |
| IUPAC Name | barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride |
| SMILES | O=c1[n-]c(=O)c(F)c[nH]1.[Ba+2].[H-] |
| InChI | InChI=1S/C4H3FN2O2.Ba.H/c5-2-1-6-4(9)7-3(2)8;;/h1H,(H2,6,7,8,9);;/q;+2;-1/p-1 |
| InChIKey | IPYGDHUAJKRKTJ-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 64.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride?
The IUPAC name of barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride (CID 175782399) is barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride.
What is the SMILES notation for barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride?
The canonical SMILES for barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride is O=c1[n-]c(=O)c(F)c[nH]1.[Ba+2].[H-].
What is the InChIKey of barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride?
The InChIKey is IPYGDHUAJKRKTJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H3FN2O2.Ba.H/c5-2-1-6-4(9)7-3(2)8;;/h1H,(H2,6,7,8,9);;/q;+2;-1/p-1.
What are the key properties of barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride?
barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride has a molecular weight of 267.41 g/mol, XLogP of -1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);5-fluoro-1H-pyrimidin-3-ide-2,4-dione;hydride is sourced from PubChem (CID 175782399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).