C28H39N5O2 — CID 175782425
1-[7-benzyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 175782425) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 1-[7-benzyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | 1-[7-benzyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 175782425 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 1-[7-benzyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | CC1(O)CCCN(c2nc(OCC34CCCN3CCC4)nc3c2CCN(Cc2ccccc2)C3)C1 |
| InChI | InChI=1S/C28H39N5O2/c1-27(34)11-5-14-32(20-27)25-23-10-17-31(18-22-8-3-2-4-9-22)19-24(23)29-26(30-25)35-21-28-12-6-15-33(28)16-7-13-28/h2-4,8-9,34H,5-7,10-21H2,1H3 |
| InChIKey | YTGVVQLIWZBAHV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |