C22H16F3N7O3 — CID 175783072
3-[3-ethyl-4-(7H-purin-6-yloxy)phenyl]-1-[5-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione (PubChem CID 175783072) has the molecular formula C22H16F3N7O3 and a molecular weight of 483.41 g/mol. Its IUPAC name is 3-[3-ethyl-4-(7H-purin-6-yloxy)phenyl]-1-[5-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-ethyl-4-(7H-purin-6-yloxy)phenyl]-1-[5-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 175783072 |
| Molecular Formula | C22H16F3N7O3 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 3-[3-ethyl-4-(7H-purin-6-yloxy)phenyl]-1-[5-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione |
| SMILES | CCc1cc(N2C(=O)CN(c3cncc(C(F)(F)F)c3)C2=O)ccc1Oc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C22H16F3N7O3/c1-2-12-5-14(3-4-16(12)35-20-18-19(28-10-27-18)29-11-30-20)32-17(33)9-31(21(32)34)15-6-13(7-26-8-15)22(23,24)25/h3-8,10-11H,2,9H2,1H3,(H,27,28,29,30) |
| InChIKey | JJXRZSPJRYCNSV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|