About 7-fluoro-8-methyl-2H-3,1-benzoxazine
7-fluoro-8-methyl-2H-3,1-benzoxazine (PubChem CID 175783498) has the molecular formula C9H8FNO
and a molecular weight of 165.17 g/mol. Its IUPAC name is 7-fluoro-8-methyl-2H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 7-fluoro-8-methyl-2H-3,1-benzoxazine |
| PubChem CID | 175783498 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 7-fluoro-8-methyl-2H-3,1-benzoxazine |
| SMILES | Cc1c(F)ccc2c1=NCOC=2 |
| InChI | InChI=1S/C9H8FNO/c1-6-8(10)3-2-7-4-12-5-11-9(6)7/h2-4H,5H2,1H3 |
| InChIKey | INDBAHBBDSHEKC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-8-methyl-2H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-8-methyl-2H-3,1-benzoxazine?
The IUPAC name of 7-fluoro-8-methyl-2H-3,1-benzoxazine (CID 175783498) is 7-fluoro-8-methyl-2H-3,1-benzoxazine.
What is the SMILES notation for 7-fluoro-8-methyl-2H-3,1-benzoxazine?
The canonical SMILES for 7-fluoro-8-methyl-2H-3,1-benzoxazine is Cc1c(F)ccc2c1=NCOC=2.
What is the InChIKey of 7-fluoro-8-methyl-2H-3,1-benzoxazine?
The InChIKey is INDBAHBBDSHEKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO/c1-6-8(10)3-2-7-4-12-5-11-9(6)7/h2-4H,5H2,1H3.
What are the key properties of 7-fluoro-8-methyl-2H-3,1-benzoxazine?
7-fluoro-8-methyl-2H-3,1-benzoxazine has a molecular weight of 165.17 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-8-methyl-2H-3,1-benzoxazine is sourced from PubChem (CID 175783498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).