C25H30N8O5 — CID 175783854
bis[4-[[(3R,6S)-6-(hydroxymethyl)oxan-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone (PubChem CID 175783854) has the molecular formula C25H30N8O5 and a molecular weight of 522.57 g/mol. Its IUPAC name is bis[4-[[(3R,6S)-6-(hydroxymethyl)oxan-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone.
| Compound Name | bis[4-[[(3R,6S)-6-(hydroxymethyl)oxan-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 175783854 |
| Molecular Formula | C25H30N8O5 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | bis[4-[[(3R,6S)-6-(hydroxymethyl)oxan-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone |
| SMILES | O=C(c1c[nH]c2ncnc(N[C@@H]3CC[C@@H](CO)OC3)c12)c1c[nH]c2ncnc(N[C@@H]3CC[C@@H](CO)OC3)c12 |
| InChI | InChI=1S/C25H30N8O5/c34-7-15-3-1-13(9-37-15)32-24-19-17(5-26-22(19)28-11-30-24)21(36)18-6-27-23-20(18)25(31-12-29-23)33-14-2-4-16(8-35)38-10-14/h5-6,11-16,34-35H,1-4,7-10H2,(H2,26,28,30,32)(H2,27,29,31,33)/t13-,14-,15+,16+/m1/s1 |
| InChIKey | XSPFWHNSODERRV-WCVJEAGWSA-N |
| XLogP | 1.36 |
| TPSA | 183.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |