C27H27ClN4O8S2 — CID 175783996
[(2S,5R)-5-[[5-(2-chloro-4-phenoxybenzoyl)-7-methylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]oxan-2-yl]methyl methanesulfonate (PubChem CID 175783996) has the molecular formula C27H27ClN4O8S2 and a molecular weight of 635.12 g/mol. Its IUPAC name is [(2S,5R)-5-[[5-(2-chloro-4-phenoxybenzoyl)-7-methylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]oxan-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,5R)-5-[[5-(2-chloro-4-phenoxybenzoyl)-7-methylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]oxan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 175783996 |
| Molecular Formula | C27H27ClN4O8S2 |
| Molecular Weight | 635.12 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | [(2S,5R)-5-[[5-(2-chloro-4-phenoxybenzoyl)-7-methylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]oxan-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1CC[C@@H](Nc2ncnc3c2c(C(=O)c2ccc(Oc4ccccc4)cc2Cl)cn3S(C)(=O)=O)CO1 |
| InChI | InChI=1S/C27H27ClN4O8S2/c1-41(34,35)32-13-22(25(33)21-11-10-19(12-23(21)28)40-18-6-4-3-5-7-18)24-26(29-16-30-27(24)32)31-17-8-9-20(38-14-17)15-39-42(2,36)37/h3-7,10-13,16-17,20H,8-9,14-15H2,1-2H3,(H,29,30,31)/t17-,20+/m1/s1 |
| InChIKey | CDLKDPHLVGLMLO-XLIONFOSSA-N |
| XLogP | 3.85 |
| TPSA | 155.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.12 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|