C21H25F3N2O2 — CID 175784621
5-methoxy-N,2-dimethyl-N-propan-2-yl-4-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)benzenecarboximidamide (PubChem CID 175784621) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 5-methoxy-N,2-dimethyl-N-propan-2-yl-4-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)benzenecarboximidamide.
| Compound Name | 5-methoxy-N,2-dimethyl-N-propan-2-yl-4-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 175784621 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 5-methoxy-N,2-dimethyl-N-propan-2-yl-4-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(/c1cc(OC)c(C(O)(c2ccccc2)C(F)(F)F)cc1C)N(C)C(C)C |
| InChI | InChI=1S/C21H25F3N2O2/c1-13(2)26(4)19(25)16-12-18(28-5)17(11-14(16)3)20(27,21(22,23)24)15-9-7-6-8-10-15/h6-13,25,27H,1-5H3/b25-19- |
| InChIKey | NRTTZRIVNMIKLE-PLRJNAJWSA-N |
| XLogP | 4.47 |
| TPSA | 56.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|