C19H33F3O4SSi — CID 175785158
[5-(2,3,3-trimethylbutan-2-ylsilyloxy)spiro[5.5]undec-2-en-2-yl] trifluoromethanesulfonate (PubChem CID 175785158) has the molecular formula C19H33F3O4SSi and a molecular weight of 442.62 g/mol. Its IUPAC name is [5-(2,3,3-trimethylbutan-2-ylsilyloxy)spiro[5.5]undec-2-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-(2,3,3-trimethylbutan-2-ylsilyloxy)spiro[5.5]undec-2-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175785158 |
| Molecular Formula | C19H33F3O4SSi |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [5-(2,3,3-trimethylbutan-2-ylsilyloxy)spiro[5.5]undec-2-en-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)C(C)(C)[SiH2]OC1CC=C(OS(=O)(=O)C(F)(F)F)CC12CCCCC2 |
| InChI | InChI=1S/C19H33F3O4SSi/c1-16(2,3)17(4,5)28-26-15-10-9-14(25-27(23,24)19(20,21)22)13-18(15)11-7-6-8-12-18/h9,15H,6-8,10-13,28H2,1-5H3 |
| InChIKey | XTIPUCSIVGBUNM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|