About N'-(2-methylphenyl)propanimidamide;dihydrochloride
N'-(2-methylphenyl)propanimidamide;dihydrochloride (PubChem CID 175785501) has the molecular formula C10H16Cl2N2
and a molecular weight of 235.16 g/mol. Its IUPAC name is N'-(2-methylphenyl)propanimidamide;dihydrochloride.
Molecular Properties
| Compound Name | N'-(2-methylphenyl)propanimidamide;dihydrochloride |
| PubChem CID | 175785501 |
| Molecular Formula | C10H16Cl2N2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | N'-(2-methylphenyl)propanimidamide;dihydrochloride |
| SMILES | CC/C(N)=N\c1ccccc1C.Cl.Cl |
| InChI | InChI=1S/C10H14N2.2ClH/c1-3-10(11)12-9-7-5-4-6-8(9)2;;/h4-7H,3H2,1-2H3,(H2,11,12);2*1H |
| InChIKey | LKERFICIZHQNSS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-methylphenyl)propanimidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methylphenyl)propanimidamide;dihydrochloride?
The IUPAC name of N'-(2-methylphenyl)propanimidamide;dihydrochloride (CID 175785501) is N'-(2-methylphenyl)propanimidamide;dihydrochloride.
What is the SMILES notation for N'-(2-methylphenyl)propanimidamide;dihydrochloride?
The canonical SMILES for N'-(2-methylphenyl)propanimidamide;dihydrochloride is CC/C(N)=N\c1ccccc1C.Cl.Cl.
What is the InChIKey of N'-(2-methylphenyl)propanimidamide;dihydrochloride?
The InChIKey is LKERFICIZHQNSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.2ClH/c1-3-10(11)12-9-7-5-4-6-8(9)2;;/h4-7H,3H2,1-2H3,(H2,11,12);2*1H.
What are the key properties of N'-(2-methylphenyl)propanimidamide;dihydrochloride?
N'-(2-methylphenyl)propanimidamide;dihydrochloride has a molecular weight of 235.16 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methylphenyl)propanimidamide;dihydrochloride is sourced from PubChem (CID 175785501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).