C30H26F4N4O3S — CID 175785623
(R)-[(4aR)-1-(4-fluorophenyl)-6-(3,4,5-trifluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(4-ethyl-2-pyridinyl)methanol (PubChem CID 175785623) has the molecular formula C30H26F4N4O3S and a molecular weight of 598.62 g/mol. Its IUPAC name is (R)-[(4aR)-1-(4-fluorophenyl)-6-(3,4,5-trifluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(4-ethyl-2-pyridinyl)methanol.
| Compound Name | (R)-[(4aR)-1-(4-fluorophenyl)-6-(3,4,5-trifluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(4-ethyl-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 175785623 |
| Molecular Formula | C30H26F4N4O3S |
| Molecular Weight | 598.62 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | (R)-[(4aR)-1-(4-fluorophenyl)-6-(3,4,5-trifluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(4-ethyl-2-pyridinyl)methanol |
| SMILES | CCc1ccnc(C(O)[C@]23Cc4cnn(-c5ccc(F)cc5)c4C=C2CCN(S(=O)(=O)c2cc(F)c(F)c(F)c2)C3)c1 |
| InChI | InChI=1S/C30H26F4N4O3S/c1-2-18-7-9-35-26(11-18)29(39)30-15-19-16-36-38(22-5-3-21(31)4-6-22)27(19)12-20(30)8-10-37(17-30)42(40,41)23-13-24(32)28(34)25(33)14-23/h3-7,9,11-14,16,29,39H,2,8,10,15,17H2,1H3/t29?,30-/m0/s1 |
| InChIKey | LEDRNTPDYIUHQK-ZSXSBBPPSA-N |
| XLogP | 5.14 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|