About [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate
[[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate (PubChem CID 175785851) has the molecular formula C20H19F4NO4
and a molecular weight of 413.37 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate.
Molecular Properties
| Compound Name | [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate |
| PubChem CID | 175785851 |
| Molecular Formula | C20H19F4NO4 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate |
| SMILES | CCCCC(=O)ONC(c1ccc(-c2cc(C=O)ccc2O)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C20H19F4NO4/c1-2-3-4-18(28)29-25-19(20(22,23)24)13-6-7-14(16(21)10-13)15-9-12(11-26)5-8-17(15)27/h5-11,19,25,27H,2-4H2,1H3 |
| InChIKey | JLCRLTRCCXWEHJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate?
The IUPAC name of [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate (CID 175785851) is [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate.
What is the SMILES notation for [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate?
The canonical SMILES for [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate is CCCCC(=O)ONC(c1ccc(-c2cc(C=O)ccc2O)c(F)c1)C(F)(F)F.
What is the InChIKey of [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate?
The InChIKey is JLCRLTRCCXWEHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F4NO4/c1-2-3-4-18(28)29-25-19(20(22,23)24)13-6-7-14(16(21)10-13)15-9-12(11-26)5-8-17(15)27/h5-11,19,25,27H,2-4H2,1H3.
What are the key properties of [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate?
[[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate has a molecular weight of 413.37 g/mol, XLogP of 4.85, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,2,2-trifluoro-1-[3-fluoro-4-(5-formyl-2-hydroxyphenyl)phenyl]ethyl]amino] pentanoate is sourced from PubChem (CID 175785851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).