C23H28F4N4O5S — CID 175786220
2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-N-[(1-fluorocyclopentyl)methyl]-N-methylacetamide (PubChem CID 175786220) has the molecular formula C23H28F4N4O5S and a molecular weight of 548.56 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-N-[(1-fluorocyclopentyl)methyl]-N-methylacetamide.
| Compound Name | 2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-N-[(1-fluorocyclopentyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 175786220 |
| Molecular Formula | C23H28F4N4O5S |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-N-[(1-fluorocyclopentyl)methyl]-N-methylacetamide |
| SMILES | CN(CC1(F)CCCC1)C(=O)CS[C@@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C23H28F4N4O5S/c1-30(11-23(27)4-2-3-5-23)17(33)10-37-22-21(35)19(20(34)16(9-32)36-22)31-8-15(28-29-31)12-6-13(24)18(26)14(25)7-12/h6-8,16,19-22,32,34-35H,2-5,9-11H2,1H3/t16-,19+,20+,21-,22+/m1/s1 |
| InChIKey | OTQWXROZJSQLIG-UGTAXJHQSA-N |
| XLogP | 1.82 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|