About 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol
4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol (PubChem CID 175786677) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol.
Molecular Properties
| Compound Name | 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol |
| PubChem CID | 175786677 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol |
| SMILES | OCCCCNc1ccc2nccn2n1 |
| InChI | InChI=1S/C10H14N4O/c15-8-2-1-5-11-9-3-4-10-12-6-7-14(10)13-9/h3-4,6-7,15H,1-2,5,8H2,(H,11,13) |
| InChIKey | SQFXHPWOUBLSDH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol?
The IUPAC name of 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol (CID 175786677) is 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol.
What is the SMILES notation for 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol?
The canonical SMILES for 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol is OCCCCNc1ccc2nccn2n1.
What is the InChIKey of 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol?
The InChIKey is SQFXHPWOUBLSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c15-8-2-1-5-11-9-3-4-10-12-6-7-14(10)13-9/h3-4,6-7,15H,1-2,5,8H2,(H,11,13).
What are the key properties of 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol?
4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol has a molecular weight of 206.25 g/mol, XLogP of 0.91, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(imidazo[1,2-b]pyridazin-6-ylamino)butan-1-ol is sourced from PubChem (CID 175786677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).