About 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one
2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one (PubChem CID 175786814) has the molecular formula C16H34OSi2
and a molecular weight of 298.62 g/mol. Its IUPAC name is 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one.
Molecular Properties
| Compound Name | 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one |
| PubChem CID | 175786814 |
| Molecular Formula | C16H34OSi2 |
| Molecular Weight | 298.62 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one |
| SMILES | CC[Si](CC)(CC)C(C(C)=C=O)[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H34OSi2/c1-8-18(9-2,10-3)16(15(7)14-17)19(11-4,12-5)13-6/h16H,8-13H2,1-7H3 |
| InChIKey | AAJGODAGTPYSPY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one?
The IUPAC name of 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one (CID 175786814) is 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one.
What is the SMILES notation for 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one?
The canonical SMILES for 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one is CC[Si](CC)(CC)C(C(C)=C=O)[Si](CC)(CC)CC.
What is the InChIKey of 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one?
The InChIKey is AAJGODAGTPYSPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34OSi2/c1-8-18(9-2,10-3)16(15(7)14-17)19(11-4,12-5)13-6/h16H,8-13H2,1-7H3.
What are the key properties of 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one?
2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one has a molecular weight of 298.62 g/mol, XLogP of 5.69, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,3-bis(triethylsilyl)prop-1-en-1-one is sourced from PubChem (CID 175786814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).