C28H28F2N6O2 — CID 175787067
4-[1-[(1S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]-2-oxoethyl]-1-methylpyrazole-5-carboxamide (PubChem CID 175787067) has the molecular formula C28H28F2N6O2 and a molecular weight of 518.57 g/mol. Its IUPAC name is 4-[1-[(1S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]-2-oxoethyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-[1-[(1S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]-2-oxoethyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175787067 |
| Molecular Formula | C28H28F2N6O2 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 4-[1-[(1S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]-2-oxoethyl]-1-methylpyrazole-5-carboxamide |
| SMILES | Cc1n[nH]c(C)c1-c1ccc(NC(=O)C(c2cnn(C)c2C(N)=O)[C@@H]2CCCc3c(F)cc(F)cc32)cc1 |
| InChI | InChI=1S/C28H28F2N6O2/c1-14-24(15(2)35-34-14)16-7-9-18(10-8-16)33-28(38)25(22-13-32-36(3)26(22)27(31)37)20-6-4-5-19-21(20)11-17(29)12-23(19)30/h7-13,20,25H,4-6H2,1-3H3,(H2,31,37)(H,33,38)(H,34,35)/t20-,25?/m1/s1 |
| InChIKey | YZFIJNLJONZKMG-VGOKPJQXSA-N |
| XLogP | 4.65 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |