C16H20N8 — CID 175788389
9-[[3-(3-aminopiperidin-1-yl)-4-pyridinyl]methyl]purin-6-amine (PubChem CID 175788389) has the molecular formula C16H20N8 and a molecular weight of 324.39 g/mol. Its IUPAC name is 9-[[3-(3-aminopiperidin-1-yl)-4-pyridinyl]methyl]purin-6-amine.
| Compound Name | 9-[[3-(3-aminopiperidin-1-yl)-4-pyridinyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 175788389 |
| Molecular Formula | C16H20N8 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 9-[[3-(3-aminopiperidin-1-yl)-4-pyridinyl]methyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2Cc1ccncc1N1CCCC(N)C1 |
| InChI | InChI=1S/C16H20N8/c17-12-2-1-5-23(8-12)13-6-19-4-3-11(13)7-24-10-22-14-15(18)20-9-21-16(14)24/h3-4,6,9-10,12H,1-2,5,7-8,17H2,(H2,18,20,21) |
| InChIKey | XHIUOCCBLLAHIT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |