C25H39N — CID 175788549
N-(3-methylbutyl)-2-[(8S,9S,10R,13S,14S)-10-methyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-13-yl]ethanimine (PubChem CID 175788549) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[(8S,9S,10R,13S,14S)-10-methyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-13-yl]ethanimine.
| Compound Name | N-(3-methylbutyl)-2-[(8S,9S,10R,13S,14S)-10-methyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-13-yl]ethanimine |
|---|---|
| PubChem CID | 175788549 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | N-(3-methylbutyl)-2-[(8S,9S,10R,13S,14S)-10-methyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-13-yl]ethanimine |
| SMILES | CC(C)CC/N=C/C[C@@]12C=CC[C@H]1[C@@H]1CC=C3CCCC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C25H39N/c1-19(2)12-17-26-18-16-25-14-6-8-23(25)21-10-9-20-7-4-5-13-24(20,3)22(21)11-15-25/h6,9,14,18-19,21-23H,4-5,7-8,10-13,15-17H2,1-3H3/b26-18+/t21-,22+,23+,24+,25+/m1/s1 |
| InChIKey | STOJSBPKZNGXGQ-SHNUVHQVSA-N |
| XLogP | 6.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|