C16H23NO3 — CID 175788612
1-[1-(7-ethoxy-1-benzofuran-2-yl)ethylamino]-2-methylpropan-2-ol (PubChem CID 175788612) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 175788612 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethylamino]-2-methylpropan-2-ol |
| SMILES | CCOc1cccc2cc(C(C)NCC(C)(C)O)oc12 |
| InChI | InChI=1S/C16H23NO3/c1-5-19-13-8-6-7-12-9-14(20-15(12)13)11(2)17-10-16(3,4)18/h6-9,11,17-18H,5,10H2,1-4H3 |
| InChIKey | OYFFDDFEDHXLIB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |