C11H13N5O3 — CID 175788880
2-amino-8-cyclopentyl-3,5-dihydropteridine-4,6,7-trione (PubChem CID 175788880) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-amino-8-cyclopentyl-3,5-dihydropteridine-4,6,7-trione.
| Compound Name | 2-amino-8-cyclopentyl-3,5-dihydropteridine-4,6,7-trione |
|---|---|
| PubChem CID | 175788880 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-amino-8-cyclopentyl-3,5-dihydropteridine-4,6,7-trione |
| SMILES | Nc1nc2c([nH]c(=O)c(=O)n2C2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13N5O3/c12-11-14-7-6(8(17)15-11)13-9(18)10(19)16(7)5-3-1-2-4-5/h5H,1-4H2,(H,13,18)(H3,12,14,15,17) |
| InChIKey | VCIPVHIWGQUVAV-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|