About 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate
2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate (PubChem CID 175790363) has the molecular formula C25H31N3O2
and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate.
Molecular Properties
| Compound Name | 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate |
| PubChem CID | 175790363 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.Cc1ccccc1-c1c2c(nn1Cc1ccccc1)CN(C)C2 |
| InChI | InChI=1S/C20H21N3.C5H10O2/c1-15-8-6-7-11-17(15)20-18-13-22(2)14-19(18)21-23(20)12-16-9-4-3-5-10-16;1-5(2,3)7-4-6/h3-11H,12-14H2,1-2H3;4H,1-3H3 |
| InChIKey | OHHPYRLODNYWEB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate?
The IUPAC name of 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate (CID 175790363) is 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate.
What is the SMILES notation for 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate?
The canonical SMILES for 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate is CC(C)(C)OC=O.Cc1ccccc1-c1c2c(nn1Cc1ccccc1)CN(C)C2.
What is the InChIKey of 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate?
The InChIKey is OHHPYRLODNYWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3.C5H10O2/c1-15-8-6-7-11-17(15)20-18-13-22(2)14-19(18)21-23(20)12-16-9-4-3-5-10-16;1-5(2,3)7-4-6/h3-11H,12-14H2,1-2H3;4H,1-3H3.
What are the key properties of 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate?
2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate has a molecular weight of 405.54 g/mol, XLogP of 4.81, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-methyl-3-(2-methylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole;tert-butyl formate is sourced from PubChem (CID 175790363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).