C18H26F6N2O2 — CID 175790465
(2R)-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-N-[(4-methyloxan-4-yl)methyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 175790465) has the molecular formula C18H26F6N2O2 and a molecular weight of 416.41 g/mol. Its IUPAC name is (2R)-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-N-[(4-methyloxan-4-yl)methyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2R)-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-N-[(4-methyloxan-4-yl)methyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 175790465 |
| Molecular Formula | C18H26F6N2O2 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (2R)-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-N-[(4-methyloxan-4-yl)methyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | CC1(CNC(=O)[C@@]2(C(C(F)(F)F)C(F)(F)F)CC23CCNCC3)CCOCC1 |
| InChI | InChI=1S/C18H26F6N2O2/c1-14(4-8-28-9-5-14)11-26-13(27)16(10-15(16)2-6-25-7-3-15)12(17(19,20)21)18(22,23)24/h12,25H,2-11H2,1H3,(H,26,27)/t16-/m0/s1 |
| InChIKey | APXGCIGIGXZWLN-INIZCTEOSA-N |
| XLogP | 3.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |