C17H15N3O5S — CID 175791061
[6-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1-benzofuran-4-yl] methanesulfonate (PubChem CID 175791061) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is [6-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1-benzofuran-4-yl] methanesulfonate.
| Compound Name | [6-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1-benzofuran-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 175791061 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | [6-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1-benzofuran-4-yl] methanesulfonate |
| SMILES | COc1cc(OS(C)(=O)=O)c2cc(-c3cn4nc(C)ccc4n3)oc2c1 |
| InChI | InChI=1S/C17H15N3O5S/c1-10-4-5-17-18-13(9-20(17)19-10)16-8-12-14(24-16)6-11(23-2)7-15(12)25-26(3,21)22/h4-9H,1-3H3 |
| InChIKey | RILNDSYPXVLZRF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|