C25H32FN5O2 — CID 175791491
3-[6-[[(3aR,6aS)-2-[dideuterio-[(3S)-oxan-3-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-5-fluoro-N-methylbenzamide (PubChem CID 175791491) has the molecular formula C25H32FN5O2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 3-[6-[[(3aR,6aS)-2-[dideuterio-[(3S)-oxan-3-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-5-fluoro-N-methylbenzamide.
| Compound Name | 3-[6-[[(3aR,6aS)-2-[dideuterio-[(3S)-oxan-3-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-5-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 175791491 |
| Molecular Formula | C25H32FN5O2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 3-[6-[[(3aR,6aS)-2-[dideuterio-[(3S)-oxan-3-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-5-fluoro-N-methylbenzamide |
| SMILES | [2H]C([2H])([C@@H]1CCCOC1)N1C[C@H]2CC(Nc3ccc(-c4cc(F)cc(C(=O)NC)c4)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C25H32FN5O2/c1-27-25(32)18-7-17(8-21(26)9-18)23-4-5-24(30-29-23)28-22-10-19-13-31(14-20(19)11-22)12-16-3-2-6-33-15-16/h4-5,7-9,16,19-20,22H,2-3,6,10-15H2,1H3,(H,27,32)(H,28,30)/t16-,19-,20+,22?/m0/s1/i12D2 |
| InChIKey | AXTPKOJZNQJCOO-BYODZDGTSA-N |
| XLogP | 3.19 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |