C24H31NO2 — CID 175792010
(1S,2R)-2-[6-(2,3-dihydro-1H-inden-2-yloxy)hexoxy]-2,3-dihydro-1H-inden-1-amine (PubChem CID 175792010) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (1S,2R)-2-[6-(2,3-dihydro-1H-inden-2-yloxy)hexoxy]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,2R)-2-[6-(2,3-dihydro-1H-inden-2-yloxy)hexoxy]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 175792010 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (1S,2R)-2-[6-(2,3-dihydro-1H-inden-2-yloxy)hexoxy]-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@H]1c2ccccc2C[C@H]1OCCCCCCOC1Cc2ccccc2C1 |
| InChI | InChI=1S/C24H31NO2/c25-24-22-12-6-5-11-20(22)17-23(24)27-14-8-2-1-7-13-26-21-15-18-9-3-4-10-19(18)16-21/h3-6,9-12,21,23-24H,1-2,7-8,13-17,25H2/t23-,24+/m1/s1 |
| InChIKey | IBZYCUDJKATWBY-RPWUZVMVSA-N |
| XLogP | 4.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|