About 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride
5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride (PubChem CID 175793064) has the molecular formula C7H10ClNS
and a molecular weight of 175.68 g/mol. Its IUPAC name is 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride.
Analyze 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride?
The IUPAC name of 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride (CID 175793064) is 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride.
What is the SMILES notation for 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride?
The canonical SMILES for 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride is C1=CC2=CNCCC2S1.Cl.
What is the InChIKey of 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride?
The InChIKey is VBXAGIMGBOTTPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS.ClH/c1-3-8-5-6-2-4-9-7(1)6;/h2,4-5,7-8H,1,3H2;1H.
What are the key properties of 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride?
5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride has a molecular weight of 175.68 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine;hydrochloride is sourced from PubChem (CID 175793064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).