C10H8ClN7 — CID 175793268
1-(6-chloroquinazolin-4-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 175793268) has the molecular formula C10H8ClN7 and a molecular weight of 261.68 g/mol. Its IUPAC name is 1-(6-chloroquinazolin-4-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(6-chloroquinazolin-4-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 175793268 |
| Molecular Formula | C10H8ClN7 |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 1-(6-chloroquinazolin-4-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(N)n(-c2ncnc3ccc(Cl)cc23)n1 |
| InChI | InChI=1S/C10H8ClN7/c11-5-1-2-7-6(3-5)8(15-4-14-7)18-10(13)16-9(12)17-18/h1-4H,(H4,12,13,16,17) |
| InChIKey | BTLOOSSIWWCJCX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |