C12H18O2 — CID 175793271
1,2,2,3,3,4,4,4a,5,5,6,7-dodecadeuterio-6-methoxy-7H-naphthalene-1-carbaldehyde (PubChem CID 175793271) has the molecular formula C12H18O2 and a molecular weight of 206.35 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,4a,5,5,6,7-dodecadeuterio-6-methoxy-7H-naphthalene-1-carbaldehyde.
| Compound Name | 1,2,2,3,3,4,4,4a,5,5,6,7-dodecadeuterio-6-methoxy-7H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 175793271 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.21 |
| IUPAC Name | 1,2,2,3,3,4,4,4a,5,5,6,7-dodecadeuterio-6-methoxy-7H-naphthalene-1-carbaldehyde |
| SMILES | [2H]C1C=C2C([2H])(C=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C2([2H])C([2H])([2H])C1([2H])OC |
| InChI | InChI=1S/C12H18O2/c1-14-11-5-6-12-9(7-11)3-2-4-10(12)8-13/h6,8-11H,2-5,7H2,1H3/i2D2,3D2,4D2,5D,7D2,9D,10D,11D |
| InChIKey | SMSNQLAQAFNXRO-IHBIHLESSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|