C11H12FN3 — CID 175793506
(2R)-2-fluoro-1,2,3,4,4a,5-hexahydropyrido[2,3-f][1,7]naphthyridine (PubChem CID 175793506) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is (2R)-2-fluoro-1,2,3,4,4a,5-hexahydropyrido[2,3-f][1,7]naphthyridine.
| Compound Name | (2R)-2-fluoro-1,2,3,4,4a,5-hexahydropyrido[2,3-f][1,7]naphthyridine |
|---|---|
| PubChem CID | 175793506 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (2R)-2-fluoro-1,2,3,4,4a,5-hexahydropyrido[2,3-f][1,7]naphthyridine |
| SMILES | F[C@@H]1CCC2NC=c3ncccc3=C2N1 |
| InChI | InChI=1S/C11H12FN3/c12-10-4-3-8-11(15-10)7-2-1-5-13-9(7)6-14-8/h1-2,5-6,8,10,14-15H,3-4H2/t8?,10-/m0/s1 |
| InChIKey | HUGCGOIKXXVEEF-HTLJXXAVSA-N |
| XLogP | -0.42 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|