C20H22ClNO2 — CID 175794277
11-(2-methylprop-2-enoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol;hydrochloride (PubChem CID 175794277) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 11-(2-methylprop-2-enoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol;hydrochloride.
| Compound Name | 11-(2-methylprop-2-enoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 175794277 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 11-(2-methylprop-2-enoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol;hydrochloride |
| SMILES | C=C(C)COc1cccc2c1-c1cc(O)cc3c1C(C2)NCC3.Cl |
| InChI | InChI=1S/C20H21NO2.ClH/c1-12(2)11-23-18-5-3-4-13-9-17-19-14(6-7-21-17)8-15(22)10-16(19)20(13)18;/h3-5,8,10,17,21-22H,1,6-7,9,11H2,2H3;1H |
| InChIKey | BAXDGATXBUZJIB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|