C17H24BrN5OSi — CID 175794450
2-[[5-bromo-3-(1-ethylpyrazol-4-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 175794450) has the molecular formula C17H24BrN5OSi and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-[[5-bromo-3-(1-ethylpyrazol-4-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-3-(1-ethylpyrazol-4-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 175794450 |
| Molecular Formula | C17H24BrN5OSi |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[[5-bromo-3-(1-ethylpyrazol-4-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCn1cc(-c2nn(COCC[Si](C)(C)C)c3ncc(Br)cc23)cn1 |
| InChI | InChI=1S/C17H24BrN5OSi/c1-5-22-11-13(9-20-22)16-15-8-14(18)10-19-17(15)23(21-16)12-24-6-7-25(2,3)4/h8-11H,5-7,12H2,1-4H3 |
| InChIKey | HSUPDMVNNMFMGJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|