C15H19NO3S — CID 175794552
(thiophen-2-ylmethylideneamino) 2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]acetate (PubChem CID 175794552) has the molecular formula C15H19NO3S and a molecular weight of 293.40 g/mol. Its IUPAC name is (thiophen-2-ylmethylideneamino) 2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]acetate.
| Compound Name | (thiophen-2-ylmethylideneamino) 2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]acetate |
|---|---|
| PubChem CID | 175794552 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (thiophen-2-ylmethylideneamino) 2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]acetate |
| SMILES | CC(=O)[C@H]1C[C@H](C1(C)C)CC(=O)ON=CC2=CC=CS2 |
| InChI | InChI=1S/C15H19NO3S/c1-10(17)13-7-11(15(13,2)3)8-14(18)19-16-9-12-5-4-6-20-12/h4-6,9,11,13H,7-8H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | UTEKOYZFKPDPJB-WCQYABFASA-N |
| XLogP | 3.00 |
| TPSA | 84.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 419 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|