C21H14ClFN6O — CID 175794643
6-chloro-3-fluoro-2-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-1,5-naphthyridin-4-amine (PubChem CID 175794643) has the molecular formula C21H14ClFN6O and a molecular weight of 420.84 g/mol. Its IUPAC name is 6-chloro-3-fluoro-2-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-1,5-naphthyridin-4-amine.
| Compound Name | 6-chloro-3-fluoro-2-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 175794643 |
| Molecular Formula | C21H14ClFN6O |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 6-chloro-3-fluoro-2-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-1,5-naphthyridin-4-amine |
| SMILES | Cc1cc(-c2nc3ccc(Cl)nc3c(N)c2F)ccc1Oc1ccn2ncnc2c1 |
| InChI | InChI=1S/C21H14ClFN6O/c1-11-8-12(20-18(23)19(24)21-14(27-20)3-5-16(22)28-21)2-4-15(11)30-13-6-7-29-17(9-13)25-10-26-29/h2-10H,1H3,(H2,24,27) |
| InChIKey | XBMZNVWFEQWWQF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|