C19H26N6O3S — CID 175795548
amino-[4-[6-cyclopropyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-b]pyridazin-2-yl]-2-methylpentan-2-yl]-oxidosulfanium (PubChem CID 175795548) has the molecular formula C19H26N6O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is amino-[4-[6-cyclopropyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-b]pyridazin-2-yl]-2-methylpentan-2-yl]-oxidosulfanium.
| Compound Name | amino-[4-[6-cyclopropyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-b]pyridazin-2-yl]-2-methylpentan-2-yl]-oxidosulfanium |
|---|---|
| PubChem CID | 175795548 |
| Molecular Formula | C19H26N6O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | amino-[4-[6-cyclopropyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-b]pyridazin-2-yl]-2-methylpentan-2-yl]-oxidosulfanium |
| SMILES | CC(CC(C)(C)[S+](N)[O-])c1cn2nc(C3CC3)cc(N3CC(=O)N(C)C3=O)c2n1 |
| InChI | InChI=1S/C19H26N6O3S/c1-11(8-19(2,3)29(20)28)14-9-25-17(21-14)15(7-13(22-25)12-5-6-12)24-10-16(26)23(4)18(24)27/h7,9,11-12H,5-6,8,10,20H2,1-4H3 |
| InChIKey | RLNZQXHABWKLTF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|