About adamantane;ruthenium(2+)
adamantane;ruthenium(2+) (PubChem CID 175795757) has the molecular formula C10H16Ru+2
and a molecular weight of 237.31 g/mol. Its IUPAC name is adamantane;ruthenium(2+).
Molecular Properties
| Compound Name | adamantane;ruthenium(2+) |
| PubChem CID | 175795757 |
| Molecular Formula | C10H16Ru+2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | adamantane;ruthenium(2+) |
| SMILES | C1C2CC3CC1CC(C2)C3.[Ru+2] |
| InChI | InChI=1S/C10H16.Ru/c1-7-2-9-4-8(1)5-10(3-7)6-9;/h7-10H,1-6H2;/q;+2 |
| InChIKey | DVALTVNFJUKUKQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;ruthenium(2+)?
The IUPAC name of adamantane;ruthenium(2+) (CID 175795757) is adamantane;ruthenium(2+).
What is the SMILES notation for adamantane;ruthenium(2+)?
The canonical SMILES for adamantane;ruthenium(2+) is C1C2CC3CC1CC(C2)C3.[Ru+2].
What is the InChIKey of adamantane;ruthenium(2+)?
The InChIKey is DVALTVNFJUKUKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.Ru/c1-7-2-9-4-8(1)5-10(3-7)6-9;/h7-10H,1-6H2;/q;+2.
What are the key properties of adamantane;ruthenium(2+)?
adamantane;ruthenium(2+) has a molecular weight of 237.31 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;ruthenium(2+) is sourced from PubChem (CID 175795757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).