C5H14N18O4 — CID 175796352
N-[3-amino-5-(5-amino-4-nitramido-1,2,4-triazol-3-yl)-1,2,4-triazol-4-yl]nitramide;1,1,2-triaminoguanidine (PubChem CID 175796352) has the molecular formula C5H14N18O4 and a molecular weight of 390.29 g/mol. Its IUPAC name is N-[3-amino-5-(5-amino-4-nitramido-1,2,4-triazol-3-yl)-1,2,4-triazol-4-yl]nitramide;1,1,2-triaminoguanidine.
| Compound Name | N-[3-amino-5-(5-amino-4-nitramido-1,2,4-triazol-3-yl)-1,2,4-triazol-4-yl]nitramide;1,1,2-triaminoguanidine |
|---|---|
| PubChem CID | 175796352 |
| Molecular Formula | C5H14N18O4 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[3-amino-5-(5-amino-4-nitramido-1,2,4-triazol-3-yl)-1,2,4-triazol-4-yl]nitramide;1,1,2-triaminoguanidine |
| SMILES | NN=C(N)N(N)N.Nc1nnc(-c2nnc(N)n2N[N+](=O)[O-])n1N[N+](=O)[O-] |
| InChI | InChI=1S/C4H6N12O4.CH8N6/c5-3-9-7-1(13(3)11-15(17)18)2-8-10-4(6)14(2)12-16(19)20;2-1(6-3)7(4)5/h11-12H,(H2,5,9)(H2,6,10);3-5H2,(H2,2,6) |
| InChIKey | CFCQWAHKWYGSAV-UHFFFAOYSA-N |
| XLogP | -5.60 |
| TPSA | 343.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|