About 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol
1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol (PubChem CID 175796651) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol |
| PubChem CID | 175796651 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol |
| SMILES | OC1CCN([C@H]2c3ccccc3-c3cncn32)C1 |
| InChI | InChI=1S/C14H15N3O/c18-10-5-6-16(8-10)14-12-4-2-1-3-11(12)13-7-15-9-17(13)14/h1-4,7,9-10,14,18H,5-6,8H2/t10?,14-/m1/s1 |
| InChIKey | ARCIGLJQPROIFS-LNUXAPHWSA-N |
| XLogP | 1.48 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol?
The IUPAC name of 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol (CID 175796651) is 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol?
The canonical SMILES for 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol is OC1CCN([C@H]2c3ccccc3-c3cncn32)C1.
What is the InChIKey of 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol?
The InChIKey is ARCIGLJQPROIFS-LNUXAPHWSA-N. The full InChI is InChI=1S/C14H15N3O/c18-10-5-6-16(8-10)14-12-4-2-1-3-11(12)13-7-15-9-17(13)14/h1-4,7,9-10,14,18H,5-6,8H2/t10?,14-/m1/s1.
What are the key properties of 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol?
1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol has a molecular weight of 241.29 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]pyrrolidin-3-ol is sourced from PubChem (CID 175796651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).