About bis(2-morpholin-4-ylpropanamide);hydrate
bis(2-morpholin-4-ylpropanamide);hydrate (PubChem CID 175797150) has the molecular formula C14H30N4O5
and a molecular weight of 334.42 g/mol. Its IUPAC name is bis(2-morpholin-4-ylpropanamide);hydrate.
Molecular Properties
| Compound Name | bis(2-morpholin-4-ylpropanamide);hydrate |
| PubChem CID | 175797150 |
| Molecular Formula | C14H30N4O5 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | bis(2-morpholin-4-ylpropanamide);hydrate |
| SMILES | CC(C(N)=O)N1CCOCC1.CC(C(N)=O)N1CCOCC1.O |
| InChI | InChI=1S/2C7H14N2O2.H2O/c2*1-6(7(8)10)9-2-4-11-5-3-9;/h2*6H,2-5H2,1H3,(H2,8,10);1H2 |
| InChIKey | NMXPAAPHFHVMFJ-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-morpholin-4-ylpropanamide);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-morpholin-4-ylpropanamide);hydrate?
The IUPAC name of bis(2-morpholin-4-ylpropanamide);hydrate (CID 175797150) is bis(2-morpholin-4-ylpropanamide);hydrate.
What is the SMILES notation for bis(2-morpholin-4-ylpropanamide);hydrate?
The canonical SMILES for bis(2-morpholin-4-ylpropanamide);hydrate is CC(C(N)=O)N1CCOCC1.CC(C(N)=O)N1CCOCC1.O.
What is the InChIKey of bis(2-morpholin-4-ylpropanamide);hydrate?
The InChIKey is NMXPAAPHFHVMFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H14N2O2.H2O/c2*1-6(7(8)10)9-2-4-11-5-3-9;/h2*6H,2-5H2,1H3,(H2,8,10);1H2.
What are the key properties of bis(2-morpholin-4-ylpropanamide);hydrate?
bis(2-morpholin-4-ylpropanamide);hydrate has a molecular weight of 334.42 g/mol, XLogP of -2.44, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-morpholin-4-ylpropanamide);hydrate is sourced from PubChem (CID 175797150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).