C5H7FN4 — CID 175797251
(2R)-2-fluoro-2,3,4,7-tetrahydro-1H-purine (PubChem CID 175797251) has the molecular formula C5H7FN4 and a molecular weight of 142.14 g/mol. Its IUPAC name is (2R)-2-fluoro-2,3,4,7-tetrahydro-1H-purine.
| Compound Name | (2R)-2-fluoro-2,3,4,7-tetrahydro-1H-purine |
|---|---|
| PubChem CID | 175797251 |
| Molecular Formula | C5H7FN4 |
| Molecular Weight | 142.14 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (2R)-2-fluoro-2,3,4,7-tetrahydro-1H-purine |
| SMILES | F[C@@H]1NC=C2NC=NC2N1 |
| InChI | InChI=1S/C5H7FN4/c6-5-7-1-3-4(10-5)9-2-8-3/h1-2,4-5,7,10H,(H,8,9)/t4?,5-/m1/s1 |
| InChIKey | PTLZPTDEJLBKPJ-BRJRFNKRSA-N |
| XLogP | -0.77 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.14 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|