C13H21F6NO — CID 175797712
2,2-dimethyl-6,6-bis(3,3,3-trifluoropropyl)piperidin-4-ol (PubChem CID 175797712) has the molecular formula C13H21F6NO and a molecular weight of 321.31 g/mol. Its IUPAC name is 2,2-dimethyl-6,6-bis(3,3,3-trifluoropropyl)piperidin-4-ol.
| Compound Name | 2,2-dimethyl-6,6-bis(3,3,3-trifluoropropyl)piperidin-4-ol |
|---|---|
| PubChem CID | 175797712 |
| Molecular Formula | C13H21F6NO |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2,2-dimethyl-6,6-bis(3,3,3-trifluoropropyl)piperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(CCC(F)(F)F)(CCC(F)(F)F)N1 |
| InChI | InChI=1S/C13H21F6NO/c1-10(2)7-9(21)8-11(20-10,3-5-12(14,15)16)4-6-13(17,18)19/h9,20-21H,3-8H2,1-2H3 |
| InChIKey | YEWDHZZTJSIFKI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |