About 6,8-difluoro-3,3-dimethyl-2H-quinoline
6,8-difluoro-3,3-dimethyl-2H-quinoline (PubChem CID 175797974) has the molecular formula C11H11F2N
and a molecular weight of 195.21 g/mol. Its IUPAC name is 6,8-difluoro-3,3-dimethyl-2H-quinoline.
Molecular Properties
| Compound Name | 6,8-difluoro-3,3-dimethyl-2H-quinoline |
| PubChem CID | 175797974 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 6,8-difluoro-3,3-dimethyl-2H-quinoline |
| SMILES | CC1(C)C=c2cc(F)cc(F)c2=NC1 |
| InChI | InChI=1S/C11H11F2N/c1-11(2)5-7-3-8(12)4-9(13)10(7)14-6-11/h3-5H,6H2,1-2H3 |
| InChIKey | SNXVQYYPIPAPLX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,8-difluoro-3,3-dimethyl-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-difluoro-3,3-dimethyl-2H-quinoline?
The IUPAC name of 6,8-difluoro-3,3-dimethyl-2H-quinoline (CID 175797974) is 6,8-difluoro-3,3-dimethyl-2H-quinoline.
What is the SMILES notation for 6,8-difluoro-3,3-dimethyl-2H-quinoline?
The canonical SMILES for 6,8-difluoro-3,3-dimethyl-2H-quinoline is CC1(C)C=c2cc(F)cc(F)c2=NC1.
What is the InChIKey of 6,8-difluoro-3,3-dimethyl-2H-quinoline?
The InChIKey is SNXVQYYPIPAPLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N/c1-11(2)5-7-3-8(12)4-9(13)10(7)14-6-11/h3-5H,6H2,1-2H3.
What are the key properties of 6,8-difluoro-3,3-dimethyl-2H-quinoline?
6,8-difluoro-3,3-dimethyl-2H-quinoline has a molecular weight of 195.21 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-difluoro-3,3-dimethyl-2H-quinoline is sourced from PubChem (CID 175797974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).