C13H16ClNO3 — CID 175798218
3,12,14-trioxa-7-azatetracyclo[8.6.1.05,17.011,15]heptadeca-1(16),10(17),11(15)-triene;hydrochloride (PubChem CID 175798218) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 3,12,14-trioxa-7-azatetracyclo[8.6.1.05,17.011,15]heptadeca-1(16),10(17),11(15)-triene;hydrochloride.
| Compound Name | 3,12,14-trioxa-7-azatetracyclo[8.6.1.05,17.011,15]heptadeca-1(16),10(17),11(15)-triene;hydrochloride |
|---|---|
| PubChem CID | 175798218 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3,12,14-trioxa-7-azatetracyclo[8.6.1.05,17.011,15]heptadeca-1(16),10(17),11(15)-triene;hydrochloride |
| SMILES | Cl.c1c2c3c(c4c1OCO4)CCNCC3COC2 |
| InChI | InChI=1S/C13H15NO3.ClH/c1-2-14-4-9-6-15-5-8-3-11-13(17-7-16-11)10(1)12(8)9;/h3,9,14H,1-2,4-7H2;1H |
| InChIKey | OPPHTXWRNKLHKA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |