C29H25ClFN5O4 — CID 175798399
7-[8-chloro-7-fluoro-3-[(2,3,3-trimethyl-1-oxoisoindol-5-yl)amino]isoquinolin-6-yl]-8-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylic acid (PubChem CID 175798399) has the molecular formula C29H25ClFN5O4 and a molecular weight of 562.00 g/mol. Its IUPAC name is 7-[8-chloro-7-fluoro-3-[(2,3,3-trimethyl-1-oxoisoindol-5-yl)amino]isoquinolin-6-yl]-8-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylic acid.
| Compound Name | 7-[8-chloro-7-fluoro-3-[(2,3,3-trimethyl-1-oxoisoindol-5-yl)amino]isoquinolin-6-yl]-8-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175798399 |
| Molecular Formula | C29H25ClFN5O4 |
| Molecular Weight | 562.00 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 7-[8-chloro-7-fluoro-3-[(2,3,3-trimethyl-1-oxoisoindol-5-yl)amino]isoquinolin-6-yl]-8-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylic acid |
| SMILES | Cc1c(-c2cc3cc(Nc4ccc5c(c4)C(C)(C)N(C)C5=O)ncc3c(Cl)c2F)cnc2c1N(C(=O)O)CCO2 |
| InChI | InChI=1S/C29H25ClFN5O4/c1-14-19(12-33-26-25(14)36(28(38)39)7-8-40-26)18-9-15-10-22(32-13-20(15)23(30)24(18)31)34-16-5-6-17-21(11-16)29(2,3)35(4)27(17)37/h5-6,9-13H,7-8H2,1-4H3,(H,32,34)(H,38,39) |
| InChIKey | BAGSTAFZUCYNBK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.00 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |