C27H53N2+ — CID 175798462
2-(6-butan-2-yl-5,6-diethyldecan-5-yl)-1,4-diethyl-1,5-dimethylimidazol-1-ium (PubChem CID 175798462) has the molecular formula C27H53N2+ and a molecular weight of 405.74 g/mol. Its IUPAC name is 2-(6-butan-2-yl-5,6-diethyldecan-5-yl)-1,4-diethyl-1,5-dimethylimidazol-1-ium.
| Compound Name | 2-(6-butan-2-yl-5,6-diethyldecan-5-yl)-1,4-diethyl-1,5-dimethylimidazol-1-ium |
|---|---|
| PubChem CID | 175798462 |
| Molecular Formula | C27H53N2+ |
| Molecular Weight | 405.74 g/mol |
| Exact Mass | 405.42 |
| IUPAC Name | 2-(6-butan-2-yl-5,6-diethyldecan-5-yl)-1,4-diethyl-1,5-dimethylimidazol-1-ium |
| SMILES | CCCCC(CC)(C1=NC(CC)=C(C)[N+]1(C)CC)C(CC)(CCCC)C(C)CC |
| InChI | InChI=1S/C27H53N2/c1-11-18-20-26(15-5,22(8)13-3)27(16-6,21-19-12-2)25-28-24(14-4)23(9)29(25,10)17-7/h22H,11-21H2,1-10H3/q+1 |
| InChIKey | QBKYVHZSFIJRBH-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.74 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|