About sodium;formamide;propane-1-sulfonate
sodium;formamide;propane-1-sulfonate (PubChem CID 175799475) has the molecular formula C4H10NNaO4S
and a molecular weight of 191.18 g/mol. Its IUPAC name is sodium;formamide;propane-1-sulfonate.
Molecular Properties
| Compound Name | sodium;formamide;propane-1-sulfonate |
| PubChem CID | 175799475 |
| Molecular Formula | C4H10NNaO4S |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | sodium;formamide;propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)[O-].NC=O.[Na+] |
| InChI | InChI=1S/C3H8O3S.CH3NO.Na/c1-2-3-7(4,5)6;2-1-3;/h2-3H2,1H3,(H,4,5,6);1H,(H2,2,3);/q;;+1/p-1 |
| InChIKey | OBLKMVCLWTYVHU-UHFFFAOYSA-M |
| XLogP | -3.95 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;formamide;propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;formamide;propane-1-sulfonate?
The IUPAC name of sodium;formamide;propane-1-sulfonate (CID 175799475) is sodium;formamide;propane-1-sulfonate.
What is the SMILES notation for sodium;formamide;propane-1-sulfonate?
The canonical SMILES for sodium;formamide;propane-1-sulfonate is CCCS(=O)(=O)[O-].NC=O.[Na+].
What is the InChIKey of sodium;formamide;propane-1-sulfonate?
The InChIKey is OBLKMVCLWTYVHU-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8O3S.CH3NO.Na/c1-2-3-7(4,5)6;2-1-3;/h2-3H2,1H3,(H,4,5,6);1H,(H2,2,3);/q;;+1/p-1.
What are the key properties of sodium;formamide;propane-1-sulfonate?
sodium;formamide;propane-1-sulfonate has a molecular weight of 191.18 g/mol, XLogP of -3.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;formamide;propane-1-sulfonate is sourced from PubChem (CID 175799475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).