C16H20Cl2N2O2 — CID 175799720
7-(aminomethyl)-2-(2,3-dichloro-6-methoxyphenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 175799720) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 7-(aminomethyl)-2-(2,3-dichloro-6-methoxyphenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | 7-(aminomethyl)-2-(2,3-dichloro-6-methoxyphenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 175799720 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 7-(aminomethyl)-2-(2,3-dichloro-6-methoxyphenyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | COc1ccc(Cl)c(Cl)c1C1CC2CC(CN)CC(=O)N2C1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-22-13-3-2-12(17)16(18)15(13)10-6-11-4-9(7-19)5-14(21)20(11)8-10/h2-3,9-11H,4-8,19H2,1H3 |
| InChIKey | MLBLHKVHTYXJIT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |