C27H24FN3O2 — CID 175800037
2-[[[4-[4-(cyclohexen-1-yl)-2-fluorophenyl]-1H-indazol-3-yl]amino]methyl]benzoic acid (PubChem CID 175800037) has the molecular formula C27H24FN3O2 and a molecular weight of 441.51 g/mol. Its IUPAC name is 2-[[[4-[4-(cyclohexen-1-yl)-2-fluorophenyl]-1H-indazol-3-yl]amino]methyl]benzoic acid.
| Compound Name | 2-[[[4-[4-(cyclohexen-1-yl)-2-fluorophenyl]-1H-indazol-3-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 175800037 |
| Molecular Formula | C27H24FN3O2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[[[4-[4-(cyclohexen-1-yl)-2-fluorophenyl]-1H-indazol-3-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CNc1n[nH]c2cccc(-c3ccc(C4=CCCCC4)cc3F)c12 |
| InChI | InChI=1S/C27H24FN3O2/c28-23-15-18(17-7-2-1-3-8-17)13-14-21(23)22-11-6-12-24-25(22)26(31-30-24)29-16-19-9-4-5-10-20(19)27(32)33/h4-7,9-15H,1-3,8,16H2,(H,32,33)(H2,29,30,31) |
| InChIKey | HVNAYKPQAATRLJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |