C23H36IN9O5 — CID 175800038
(2R)-2-[[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-iodophenyl)propanoic acid (PubChem CID 175800038) has the molecular formula C23H36IN9O5 and a molecular weight of 645.50 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-iodophenyl)propanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 175800038 |
| Molecular Formula | C23H36IN9O5 |
| Molecular Weight | 645.50 g/mol |
| Exact Mass | 645.19 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-iodophenyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](Cc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C23H36IN9O5/c1-13(34)31-16(4-2-10-29-22(25)26)19(35)32-17(5-3-11-30-23(27)28)20(36)33-18(21(37)38)12-14-6-8-15(24)9-7-14/h6-9,16-18H,2-5,10-12H2,1H3,(H,31,34)(H,32,35)(H,33,36)(H,37,38)(H4,25,26,29)(H4,27,28,30)/t16-,17-,18+/m0/s1 |
| InChIKey | RTQHYDUNWYQNLC-OKZBNKHCSA-N |
| XLogP | -1.50 |
| TPSA | 253.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.50 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|