C16H21N5O2 — CID 175800474
1-[(2R,3S)-3-ethyl-2-[(7H-pyrrolo[2,3-c]pyridazin-4-ylamino)methyl]morpholin-4-yl]prop-2-en-1-one (PubChem CID 175800474) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[(2R,3S)-3-ethyl-2-[(7H-pyrrolo[2,3-c]pyridazin-4-ylamino)methyl]morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,3S)-3-ethyl-2-[(7H-pyrrolo[2,3-c]pyridazin-4-ylamino)methyl]morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175800474 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[(2R,3S)-3-ethyl-2-[(7H-pyrrolo[2,3-c]pyridazin-4-ylamino)methyl]morpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCO[C@H](CNc2cnnc3[nH]ccc23)[C@@H]1CC |
| InChI | InChI=1S/C16H21N5O2/c1-3-13-14(23-8-7-21(13)15(22)4-2)10-18-12-9-19-20-16-11(12)5-6-17-16/h4-6,9,13-14H,2-3,7-8,10H2,1H3,(H2,17,18,20)/t13-,14+/m0/s1 |
| InChIKey | JVGXVNQSRIUJDO-UONOGXRCSA-N |
| XLogP | 1.56 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|