C18H23N5O2 — CID 175800621
4-[(6-methyl-1-prop-2-enoylpiperidin-3-yl)methylamino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 175800621) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 4-[(6-methyl-1-prop-2-enoylpiperidin-3-yl)methylamino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 4-[(6-methyl-1-prop-2-enoylpiperidin-3-yl)methylamino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 175800621 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[(6-methyl-1-prop-2-enoylpiperidin-3-yl)methylamino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | C=CC(=O)N1CC(CNc2c(C(N)=O)cnc3[nH]ccc23)CCC1C |
| InChI | InChI=1S/C18H23N5O2/c1-3-15(24)23-10-12(5-4-11(23)2)8-21-16-13-6-7-20-18(13)22-9-14(16)17(19)25/h3,6-7,9,11-12H,1,4-5,8,10H2,2H3,(H2,19,25)(H2,20,21,22) |
| InChIKey | YWKBYRPCVFODQX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|