C37H44FN5O4Si — CID 175801652
[8-fluoro-7-[3-(methoxymethoxy)-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-yl] 3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 175801652) has the molecular formula C37H44FN5O4Si and a molecular weight of 669.87 g/mol. Its IUPAC name is [8-fluoro-7-[3-(methoxymethoxy)-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-yl] 3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | [8-fluoro-7-[3-(methoxymethoxy)-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-yl] 3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 175801652 |
| Molecular Formula | C37H44FN5O4Si |
| Molecular Weight | 669.87 g/mol |
| Exact Mass | 669.31 |
| IUPAC Name | [8-fluoro-7-[3-(methoxymethoxy)-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-yl] 3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COCOc1cc(-c2ncc3c(OC(=O)N4C5CCC4CNC5)ncnc3c2F)c2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cccc2c1 |
| InChI | InChI=1S/C37H44FN5O4Si/c1-22(2)48(23(3)4,24(5)6)14-13-25-9-8-10-26-15-29(46-21-45-7)16-30(32(25)26)34-33(38)35-31(19-40-34)36(42-20-41-35)47-37(44)43-27-11-12-28(43)18-39-17-27/h8-10,15-16,19-20,22-24,27-28,39H,11-12,17-18,21H2,1-7H3 |
| InChIKey | SZSGUGHUAZFPKU-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.87 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|